3-methyl-1-(5-nitropyridin-2-yl)piperazine structure
|
Common Name | 3-methyl-1-(5-nitropyridin-2-yl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 773879-30-4 | Molecular Weight | 222.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1-(5-nitropyridin-2-yl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14N4O2 |
|---|---|
| Molecular Weight | 222.24400 |
| Exact Mass | 222.11200 |
| PSA | 73.98000 |
| LogP | 1.70490 |
| InChIKey | XYMPRRMVLJQEAW-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cn2)CCN1 |
| HS Code | 2933990090 |
|---|
|
~89%
3-methyl-1-(5-n... CAS#:773879-30-4 |
| Literature: Abbott GmbH and Co. KG. Patent: US2006/160809 A1, 2006 ; Location in patent: Page/Page column 27 ; US 20060160809 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| or8382 |