3-methoxy-2-(4-methylphenyl)sulfonyloxy-benzaldehyde structure
|
Common Name | 3-methoxy-2-(4-methylphenyl)sulfonyloxy-benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 7740-04-7 | Molecular Weight | 306.33400 | |
| Density | 1.303g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C15H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | (2-formyl-6-methoxyphenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.33400 |
| Flash Point | 251.5ºC |
| Exact Mass | 306.05600 |
| PSA | 78.05000 |
| LogP | 3.66460 |
| Index of Refraction | 1.577 |
| InChIKey | FCYFTQDINHXGKX-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=O)c1OS(=O)(=O)c1ccc(C)cc1 |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-methoxy-2-<(p-tolylsulfonyl)oxy>benzaldehyde |
| 2-p-Toluolsulfonyloxy-3-methoxy-benzaldehyd |
| 2-Formyl-6-methoxyphenyl 4-methylbenzenesulfonate |