[(2-cyclopent-2-en-1-ylacetyl)-prop-2-enylamino] acetate structure
|
Common Name | [(2-cyclopent-2-en-1-ylacetyl)-prop-2-enylamino] acetate | ||
|---|---|---|---|---|
| CAS Number | 77413-82-2 | Molecular Weight | 223.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2-cyclopent-2-en-1-ylacetyl)-prop-2-enylamino] acetate |
|---|
| Molecular Formula | C12H17NO3 |
|---|---|
| Molecular Weight | 223.26800 |
| Exact Mass | 223.12100 |
| PSA | 46.61000 |
| LogP | 1.83540 |
| InChIKey | KZQRMFSIWSZCAY-UHFFFAOYSA-N |
| SMILES | C=CCN(OC(C)=O)C(=O)CC1C=CCC1 |
|
~66%
[(2-cyclopent-2... CAS#:77413-82-2 |
| Literature: Cheng,Y.S.; Lupo,A.T.; Fowler,F.W. Journal of the American Chemical Society, 1983 , vol. 105, p. 7696 |
|
~%
[(2-cyclopent-2... CAS#:77413-82-2 |
| Literature: Cheng,Y.S.; Lupo,A.T.; Fowler,F.W. Journal of the American Chemical Society, 1983 , vol. 105, p. 7696 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |