2-methyl-3a-prop-2-enyl-3,5-dihydro-2H-furo[3,2-c][1,5]benzodiazepin-4-one structure
|
Common Name | 2-methyl-3a-prop-2-enyl-3,5-dihydro-2H-furo[3,2-c][1,5]benzodiazepin-4-one | ||
|---|---|---|---|---|
| CAS Number | 77414-10-9 | Molecular Weight | 256.30000 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3a-prop-2-enyl-3,5-dihydro-2H-furo[3,2-c][1,5]benzodiazepin-4-one |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Exact Mass | 256.12100 |
| PSA | 54.18000 |
| LogP | 2.56070 |
| Index of Refraction | 1.624 |
| InChIKey | SYRXCXSDXGBKQR-UHFFFAOYSA-N |
| SMILES | C=CCC12CC(C)OC1=Nc1ccccc1NC2=O |
|
~92%
2-methyl-3a-pro... CAS#:77414-10-9 |
| Literature: Wagner, Edwin Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 131 - 139 |