4H-Furo(2,3-b)(1,5)benzodiazepin-4-one, 2,3,3a,5-tetrahydro-3a-ethyl-2-methyl- structure
|
Common Name | 4H-Furo(2,3-b)(1,5)benzodiazepin-4-one, 2,3,3a,5-tetrahydro-3a-ethyl-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 77420-13-4 | Molecular Weight | 244.28900 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3a-ethyl-2-methyl-3,5-dihydro-2H-furo[3,2-c][1,5]benzodiazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 54.18000 |
| LogP | 2.39460 |
| Index of Refraction | 1.636 |
| InChIKey | JUYPOYIZBQJEDI-UHFFFAOYSA-N |
| SMILES | CCC12CC(C)OC1=Nc1ccccc1NC2=O |
| HS Code | 2934999090 |
|---|
|
~92%
4H-Furo(2,3-b)(... CAS#:77420-13-4 |
| Literature: Wagner, Edwin Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 131 - 139 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,3a,5-Tetrahydro-3a-ethyl-2-methyl-4H-furo(2,3-b)(1,5)benzodiazepin-4-one |
| 4H-Furo(2,3-b)(1,5)benzodiazepin-4-one,2,3,3a,5-tetrahydro-3a-ethyl-2-methyl |