[2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate structure
|
Common Name | [2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 77430-27-4 | Molecular Weight | 411.49100 | |
| Density | 1.136g/cm3 | Boiling Point | 534.7ºC at 760 mmHg | |
| Molecular Formula | C24H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.2ºC | |
| Name | [2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 534.7ºC at 760 mmHg |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.49100 |
| Flash Point | 277.2ºC |
| Exact Mass | 411.20500 |
| PSA | 72.91000 |
| LogP | 4.15840 |
| Index of Refraction | 1.547 |
| InChIKey | NCQOUEUIEVCLCE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cc(C(=O)CN(Cc2ccccc2)C(C)(C)C)ccc1OC(C)=O |
|
~%
[2-acetyloxy-5-... CAS#:77430-27-4 |
| Literature: Collin; Hartley; Jack; Lunts; Press; Ritchie; Toon Journal of medicinal chemistry, 1970 , vol. 13, # 4 p. 674 - 680 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Glycyl compound |
| Di-O-acetyl N-Benzyl Salbutamon |