Methyl 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylate
Modify Date: 2025-08-26 20:29:10
![Methyl 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylate Structure](https://image.chemsrc.com/caspic/105/774487-83-1.png)
Methyl 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylate structure
|
Common Name | Methyl 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 774487-83-1 | Molecular Weight | 197.27400 | |
| Density | 1.067 g/cm3 | Boiling Point | 253.929ºC at 760 mmHg | |
| Molecular Formula | C11H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.373ºC | |
| Name | Methyl 4-(methylamino)bicyclo[2.2.2]octane-1-carboxylate |
|---|
| Density | 1.067 g/cm3 |
|---|---|
| Boiling Point | 253.929ºC at 760 mmHg |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.27400 |
| Flash Point | 107.373ºC |
| Exact Mass | 197.14200 |
| PSA | 38.33000 |
| LogP | 1.86270 |
| InChIKey | OHESPTXNJUPLHB-UHFFFAOYSA-N |
| SMILES | CNC12CCC(C(=O)OC)(CC1)CC2 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |