(5-Bromo-2-chlorophenyl)boronic acid
Modify Date: 2025-09-18 22:36:27
(5-Bromo-2-chlorophenyl)boronic acid structure
|
Common Name | (5-Bromo-2-chlorophenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 774608-50-3 | Molecular Weight | 235.271 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 359.8±52.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BBrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.4±30.7 °C | |
| Name | 5-Bromo-2-chlorophenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.8±52.0 °C at 760 mmHg |
| Molecular Formula | C6H5BBrClO2 |
| Molecular Weight | 235.271 |
| Flash Point | 171.4±30.7 °C |
| Exact Mass | 233.925446 |
| PSA | 40.46000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.615 |
| HS Code | 2931900090 |
|---|
|
~%
(5-Bromo-2-chlo... CAS#:774608-50-3 |
| Literature: SYNGENTA LIMITED Patent: WO2008/145336 A1, 2008 ; Location in patent: Page/Page column 65-66 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Boronic acid, B-(5-bromo-2-chlorophenyl)- |
| Benzenamine,5-bromo-2-chloro-,hydrochloride |
| (5-Bromo-2-chlorophenyl)boronic acid |
| 5-bromo-2-chloro-phenylboronic acid |
| 5-bromo-2-chloro-phenylamine hydrochloride |
| 5-bromo-2-chloroaniline hydrochloride |