Methyl 4-acetamido-5-amino-2-methoxybenzoate structure
|
Common Name | Methyl 4-acetamido-5-amino-2-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 77495-40-0 | Molecular Weight | 238.240 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 474.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.0±28.7 °C | |
| Name | Methyl 4-acetamido-5-amino-2-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 474.9±45.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.240 |
| Flash Point | 241.0±28.7 °C |
| Exact Mass | 238.095352 |
| PSA | 94.14000 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | ZQDVARMAKLYZTA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N)c(NC(C)=O)cc1OC |
| HS Code | 2924299090 |
|---|
|
~93%
Methyl 4-acetam... CAS#:77495-40-0 |
| Literature: Eckert, Heiner; Kiesel, Yvonne Angewandte Chemie, 1981 , vol. 93, # 5 p. 477 - 479 |
|
~%
Methyl 4-acetam... CAS#:77495-40-0 |
| Literature: Hirokawa, Yoshimi; Yamazaki, Hiroshi; Yoshida, Naoyuki; Kato, Shiro Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 15 p. 1973 - 1978 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 4-(acetylamino)-5-amino-2-methoxy-, methyl ester |
| Methyl 4-acetamido-5-amino-2-methoxybenzoate |
| EINECS 278-696-2 |
| Methyl 4-(acetylamino)-5-amino-o-anisate |
| 4-Acetylamino-5-Amino-2-Methoxybenzoic Acid Methyl Ester |