Benzofluorfen structure
|
Common Name | Benzofluorfen | ||
|---|---|---|---|---|
| CAS Number | 77501-60-1 | Molecular Weight | 419.693 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 517.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H9ClF3NO7 | Melting Point | 65ºC | |
| MSDS | N/A | Flash Point | 266.9±30.1 °C | |
Use of BenzofluorfenFluoroglycofen is a herbicide used in vineyards to eradicate weeds[1]. |
| Name | fluoroglycofen |
|---|---|
| Synonym | More Synonyms |
| Description | Fluoroglycofen is a herbicide used in vineyards to eradicate weeds[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Fluoroglycofen reduces net photosynthetic rate in a dose-dependent manner, but also reduced or increased pigment contents, respectively[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.8±50.0 °C at 760 mmHg |
| Melting Point | 65ºC |
| Molecular Formula | C16H9ClF3NO7 |
| Molecular Weight | 419.693 |
| Flash Point | 266.9±30.1 °C |
| Exact Mass | 419.001953 |
| PSA | 118.65000 |
| LogP | 3.96 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | DHAHEVIQIYRFRG-UHFFFAOYSA-N |
| SMILES | O=C(O)COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| HS Code | 2918990027 |
|---|
|
~%
Benzofluorfen CAS#:77501-60-1 |
| Literature: US5304531 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, carboxymethyl ester |
| O-[5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrobenzoyl]glycolic acid |
| ({5-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl}oxy)acetic acid |
| MFCD01632760 |
| Benzoic acid,5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-,carboxymethyl ester |
| Super Blazer[R] |
| Fluoroglicofene |
| COMPETE |
| 2-chloro-4-trifluoromethyl-3'-(carboxymethoxycarbonyl)-4'-nitrodiphenyl ether |
| Fluoroglycofen [ansi:bsi:iso] |
| carboxymethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| Fluoroglicofene [iso-french] |
| Benzofluorfen |