4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl
Modify Date: 2026-07-14 08:36:30
4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl structure
|
Common Name | 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 77545-13-2 | Molecular Weight | 292.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16N2O2 |
|---|---|
| Molecular Weight | 292.3 |
| InChIKey | IQLHQDZWTJXILC-UHFFFAOYSA-N |
| SMILES | c1cc(-c2ccc(C3=NCCO3)cc2)ccc1C1=NCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl? |
| A: Molecular weight of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl is 292.3. |
| Q: What is the Chinese name of 77545-13-2? |
| A: Chinese name of 77545-13-2 is 77545-13-2. |
| Q: What is the English name of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl? |
| A: The English name of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl is 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl. |
| Q: What is the CAS number of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl? |
| A: CAS number of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl is 77545-13-2. |
| Q: What is the SMILES notation of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl? |
| A: SMILES notation of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl is c1cc(-c2ccc(C3=NCCO3)cc2)ccc1C1=NCCO1. |
| Q: What is the molecular formula of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl? |
| A: Molecular formula of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl is C18H16N2O2. |
| Q: What is the InChIKey of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl? |
| A: InChIKey of 4,4'-Bis(4,5-dihydrooxazol-2-yl)-1,1'-biphenyl is IQLHQDZWTJXILC-UHFFFAOYSA-N. |