L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]
Modify Date: 2026-07-15 23:22:28
![L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] Structure](https://www.chemsrc.com/extcaspic/329/77553-37-8.png)
L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] structure
|
Common Name | L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] | ||
|---|---|---|---|---|
| CAS Number | 77553-37-8 | Molecular Weight | 509.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H39N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H39N3O6S |
|---|---|
| Molecular Weight | 509.7 |
| InChIKey | GYBXWOPENJVQKE-AABGKKOBSA-N |
| SMILES | CSCCC(NC(=O)OC(C)(C)C)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]? |
| A: InChIKey of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] is GYBXWOPENJVQKE-AABGKKOBSA-N. |
| Q: What is the English name of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]? |
| A: The English name of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] is L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]. |
| Q: What is the SMILES notation of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]? |
| A: SMILES notation of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] is CSCCC(NC(=O)OC(C)(C)C)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(=O)O. |
| Q: What is the CAS number of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]? |
| A: CAS number of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] is 77553-37-8. |
| Q: What is the molecular weight of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]? |
| A: Molecular weight of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] is 509.7. |
| Q: What is the molecular formula of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl]? |
| A: Molecular formula of L-Phenylalanine, N-[N-[N-[(1,1-dimethylethoxy)carbonyl]-D-methionyl]-L-leucyl] is C25H39N3O6S. |
| Q: What is the Chinese name of 77553-37-8? |
| A: Chinese name of 77553-37-8 is 77553-37-8. |