Ingenol-3,4:5,20-diacetonide structure
|
Common Name | Ingenol-3,4:5,20-diacetonide | ||
|---|---|---|---|---|
| CAS Number | 77573-44-5 | Molecular Weight | 428.561 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 521.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H36O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.9±30.2 °C | |
Use of Ingenol-3,4:5,20-diacetonideIngenol-3,4,5,20-diacetonide is a natural compound. |
| Name | ingenol-3,4:5,20-diacetonide |
|---|---|
| Synonym | More Synonyms |
| Description | Ingenol-3,4,5,20-diacetonide is a natural compound. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 521.0±50.0 °C at 760 mmHg |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.561 |
| Flash Point | 222.9±30.2 °C |
| Exact Mass | 428.256287 |
| PSA | 53.99000 |
| LogP | 6.38 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | JOKBBQPBIIZMJV-OAWSJXCJSA-N |
| SMILES | CC1=CC23C(=O)C(C=C4COC(C)(C)OC4C24OC(C)(C)OC14)C1C(CC3C)C1(C)C |
| Storage condition | 2-8℃ |
| 3,6,6,11,11,18,18,21-Octamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.0.0.0.0]docosa-2,14-dien-22-one |
| 10aH-2,12a-Methano-1H,4H-cyclopropa(5,6)(1,3)dioxolo(2',3')cyclopenta(1',2':9,10)cyclodeca(1,2-d)(1,3)dioxin-15-one,1a,2,7a,13,14,14a-hexahydro-1,1,6,6,9,9,11,13-octamethyl-,(1aR-(1aalpha,2alpha,7aalpha,7bR*,10aalpha,12aalpha,13alpha,14aalpha)) |
| 10H-9a,13-Methano-1H,7aH-cyclopropa[5,6][1,3]dioxolo[2',3']cyclopenta[1',2':9,10]cyclodeca[1,2-d][1,3]dioxin-15-one, 4a,11,11a,12,12a,13-hexahydro-3,3,6,6,8,10,12,12-octamethyl- |
| 3,3,6,6,8,10,12,12-octamethyl-10,11,11a,12,12a,13-hexahydro-1H,4aH,7aH-9a,13-methanocyclopropa[5,6][1,3]dioxolo[2',3']cyclopenta[1',2':9,10]cyclodeca[1,2-d][1,3]dioxin-15-one |