8-acetyl-7-[3-(bis(2-hydroxyethyl)amino)-2-hydroxy-propoxy]-4-methyl-chromen-2-one
![8-acetyl-7-[3-(bis(2-hydroxyethyl)amino)-2-hydroxy-propoxy]-4-methyl-chromen-2-one Structure](https://image.chemsrc.com/caspic/267/77607-44-4.png)
8-acetyl-7-[3-(bis(2-hydroxyethyl)amino)-2-hydroxy-propoxy]-4-methyl-chromen-2-one structure
|
Common Name | 8-acetyl-7-[3-(bis(2-hydroxyethyl)amino)-2-hydroxy-propoxy]-4-methyl-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 77607-44-4 | Molecular Weight | 379.40400 | |
| Density | 1.309g/cm3 | Boiling Point | 632.2ºC at 760 mmHg | |
| Molecular Formula | C19H25NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.2ºC | |
Summary: 8-Acetyl-7-[3-(bis(2-hydroxyethyl)amino)-2-hydroxy-propoxy]-4-methyl-chromen-2-one (Chinese name: 8-乙酰基-7-[3-(2-羟乙基氨基)-2-羟基丙氧基]-4-甲基-2-酮，CAS number: 77607-44-4，molecular formula: C19H25NO7，molecular weight: 379.40400)，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 632.2ºC at 760 mmHg |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.40400 |
| Flash Point | 336.2ºC |
| Exact Mass | 379.16300 |
| PSA | 120.44000 |
| LogP | 0.33030 |
| Index of Refraction | 1.585 |
| InChIKey | CQBISPGCCCXAEX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(OCC(O)CN(CCO)CCO)ccc2c(C)cc(=O)oc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
8-acetyl-7-[3-(... CAS#:77607-44-4 |
| Literature: Malik, Mangel S.; Rastogi, Shri Nivas Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 2 p. 171 - 174 |
|
~%
8-acetyl-7-[3-(... CAS#:77607-44-4 |
| Literature: Malik, Mangel S.; Rastogi, Shri Nivas Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 2 p. 171 - 174 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: Molecular formula of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is C19H25NO7. |
| Q: What is the CAS number of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: CAS number of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is 77607-44-4. |
| Q: What are the upstream materials of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: Related upstream materials(CAS) of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one: 77607-32-0;111-42-2;2555-29-5. |
| Q: What is the English name of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: The English name of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one. |
| Q: What is the polar surface area (PSA) of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: Polar surface area (PSA) of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is 120.44000. |
| Q: What is the molecular weight of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: Molecular weight of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is 379.40400. |
| Q: What is the LogP of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: LogP of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is 0.33030. |
| Q: What is the InChIKey of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: InChIKey of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is CQBISPGCCCXAEX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 77607-44-4? |
| A: Chinese name of 77607-44-4 is 77607-44-4. |
| Q: What is the boiling point of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one? |
| A: Boiling point of 8-acetyl-7-[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropoxy]-4-methylchromen-2-one is 632.2ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |