WAY-325490
Modify Date: 2024-04-02 23:17:05
WAY-325490 structure
|
Common Name | WAY-325490 | ||
|---|---|---|---|---|
| CAS Number | 77607-70-6 | Molecular Weight | 295.7231 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 502.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H10ClN3O | Melting Point | 274-280 °C(Solv: benzene (71-43-2)) | |
| MSDS | N/A | Flash Point | 257.9±30.1 °C | |
Use of WAY-325490mitogen activated protein kinase-activated protein kinase-2 inhibitor; antimicrobial activity; |
| Name | WAY-325490 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 502.8±50.0 °C at 760 mmHg |
| Melting Point | 274-280 °C(Solv: benzene (71-43-2)) |
| Molecular Formula | C16H10ClN3O |
| Molecular Weight | 295.7231 |
| Flash Point | 257.9±30.1 °C |
| Exact Mass | 295.051239 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | LCAAKPMYGBRCEX-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccco2)cc(-c2ccc(Cl)cc2)nc1N |
| 2-Amino-6-(4-chlorophenyl)-4-(2-furyl)nicotinonitrile |
| 3-Pyridinecarbonitrile, 2-amino-6-(4-chlorophenyl)-4-(2-furanyl)- |