Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, 15-(2-methyl-2-propenoate), (3.alpha.,4.beta.)
Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, 15-(2-methyl-2-propenoate), (3.alpha.,4.beta.) structure
|
Common Name | Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, 15-(2-methyl-2-propenoate), (3.alpha.,4.beta.) | ||
|---|---|---|---|---|
| CAS Number | 77620-50-9 | Molecular Weight | 350.40600 | |
| Density | 1.3g/cm3 | Boiling Point | 496.4ºC at 760 mmHg | |
| Molecular Formula | C19H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.8ºC | |
Summary: 15-(methacryloyloxy)scirpene-3α,4β-diol, also known as Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, 15-(2-methyl-2-propenoate), (3.alpha.,4.beta.)-, CAS number 77620-50-9, has a molecular formula of C19H26O6 and a molecular weight of 350.40600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 15-(methacryloyloxy)scirpene-3α,4β-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760 mmHg |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.40600 |
| Flash Point | 174.8ºC |
| Exact Mass | 350.17300 |
| PSA | 88.52000 |
| LogP | 1.11030 |
| Index of Refraction | 1.581 |
| InChIKey | LFPSPFDJFGLRED-AEZJXXPFSA-N |
| SMILES | C=C(C)C(=O)OCC12CCC(C)=CC1OC1C(O)C(O)C2(C)C12CO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: Molecular weight of 15-(methacryloyloxy)scirpene-3α,4β-diol is 350.40600. |
| Q: What is the Chinese name of 77620-50-9? |
| A: Chinese name of 77620-50-9 is 77620-50-9. |
| Q: What is the polar surface area (PSA) of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: Polar surface area (PSA) of 15-(methacryloyloxy)scirpene-3α,4β-diol is 88.52000. |
| Q: What is the CAS number of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: CAS number of 15-(methacryloyloxy)scirpene-3α,4β-diol is 77620-50-9. |
| Q: What is the SMILES notation of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: SMILES notation of 15-(methacryloyloxy)scirpene-3α,4β-diol is C=C(C)C(=O)OCC12CCC(C)=CC1OC1C(O)C(O)C2(C)C12CO2. |
| Q: What is the LogP of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: LogP of 15-(methacryloyloxy)scirpene-3α,4β-diol is 1.11030. |
| Q: What is the boiling point of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: Boiling point of 15-(methacryloyloxy)scirpene-3α,4β-diol is 496.4ºC at 760 mmHg. |
| Q: What is the molecular formula of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: Molecular formula of 15-(methacryloyloxy)scirpene-3α,4β-diol is C19H26O6. |
| Q: What is the InChIKey of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: InChIKey of 15-(methacryloyloxy)scirpene-3α,4β-diol is LFPSPFDJFGLRED-AEZJXXPFSA-N. |
| Q: What is the English name of 15-(methacryloyloxy)scirpene-3α,4β-diol? |
| A: The English name of 15-(methacryloyloxy)scirpene-3α,4β-diol is 15-(methacryloyloxy)scirpene-3α,4β-diol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |