Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))
Modify Date: 2025-09-11 02:42:20
Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) structure
|
Common Name | Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) | ||
|---|---|---|---|---|
| CAS Number | 77625-72-0 | Molecular Weight | 468.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H44O4 |
|---|---|
| Molecular Weight | 468.7 |
| InChIKey | DFSIQVYXMRYQGI-WAEMMRLPSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)C(O)CC3(C)C(=CCC4C5(C)C=CC(=O)C(C)(C)C5CCC43C)C2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))? |
| A: The English name of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) is Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)). |
| Q: What is the molecular weight of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))? |
| A: Molecular weight of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) is 468.7. |
| Q: What is the CAS number of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))? |
| A: CAS number of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) is 77625-72-0. |
| Q: What is the SMILES notation of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))? |
| A: SMILES notation of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) is CC1(C)CCC2(C(=O)O)C(O)CC3(C)C(=CCC4C5(C)C=CC(=O)C(C)(C)C5CCC43C)C2C1. |
| Q: What is the Chinese name of 77625-72-0? |
| A: Chinese name of 77625-72-0 is 77625-72-0. |
| Q: What is the InChIKey of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))? |
| A: InChIKey of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) is DFSIQVYXMRYQGI-WAEMMRLPSA-N. |
| Q: What is the molecular formula of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2))? |
| A: Molecular formula of Oleana-1,12-dien-28-oic acid, 16-hydroxy-3-oxo-, (16I(2)) is C30H44O4. |