1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)
Modify Date: 2026-07-19 18:27:38
1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) | ||
|---|---|---|---|---|
| CAS Number | 7764-36-5 | Molecular Weight | 318.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H10N2O4 |
|---|---|
| Molecular Weight | 318.3 |
| InChIKey | WHCKYRJFIIFFBW-KTKRTIGZSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1C=CN1C(=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)? |
| A: Molecular weight of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) is 318.3. |
| Q: What is the English name of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)? |
| A: The English name of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) is 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z). |
| Q: What is the Chinese name of 7764-36-5? |
| A: Chinese name of 7764-36-5 is 7764-36-5. |
| Q: What is the molecular formula of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)? |
| A: Molecular formula of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) is C18H10N2O4. |
| Q: What is the InChIKey of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)? |
| A: InChIKey of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) is WHCKYRJFIIFFBW-KTKRTIGZSA-N. |
| Q: What is the CAS number of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)? |
| A: CAS number of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) is 7764-36-5. |
| Q: What is the SMILES notation of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z)? |
| A: SMILES notation of 1H-Isoindole-1,3(2H)-dione, 2,2a(2)-(1,2-ethenediyl)bis-, (Z) is O=C1c2ccccc2C(=O)N1C=CN1C(=O)c2ccccc2C1=O. |