4-[4-(dimethylamino)benzoyl]-5-methyl-1,3-dihydroimidazol-2-one structure
|
Common Name | 4-[4-(dimethylamino)benzoyl]-5-methyl-1,3-dihydroimidazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 77671-28-4 | Molecular Weight | 245.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(dimethylamino)benzoyl]-5-methyl-1,3-dihydroimidazol-2-one |
|---|
| Molecular Formula | C13H15N3O2 |
|---|---|
| Molecular Weight | 245.27700 |
| Exact Mass | 245.11600 |
| PSA | 69.22000 |
| LogP | 1.72070 |
| InChIKey | IKNGZHKAQKSTKD-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)[nH]c1C(=O)c1ccc(N(C)C)cc1 |
|
~%
4-[4-(dimethyla... CAS#:77671-28-4 |
| Literature: Merrell Dow Pharmaceuticals Inc. Patent: US4405635 A1, 1983 ; |
|
~%
4-[4-(dimethyla... CAS#:77671-28-4 |
| Literature: Schnettler; Dage; Grisar Journal of Medicinal Chemistry, 1982 , vol. 25, # 12 p. 1477 - 1481 |
|
~80%
4-[4-(dimethyla... CAS#:77671-28-4 |
| Literature: Schnettler; Dage; Grisar Journal of Medicinal Chemistry, 1982 , vol. 25, # 12 p. 1477 - 1481 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |