2-Selenazolamine,4-(3-nitrophenyl)- structure
|
Common Name | 2-Selenazolamine,4-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7770-61-8 | Molecular Weight | 268.13100 | |
| Density | N/A | Boiling Point | 474.1ºC at 760mmHg | |
| Molecular Formula | C9H7N3O2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
| Name | 4-(3-nitrophenyl)-1,3-selenazol-2-amine |
|---|
| Boiling Point | 474.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C9H7N3O2Se |
| Molecular Weight | 268.13100 |
| Flash Point | 240.5ºC |
| Exact Mass | 268.97000 |
| PSA | 84.73000 |
| LogP | 2.40040 |
| InChIKey | YGGXRCZXSUWXFJ-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2cccc([N+](=O)[O-])c2)c[se]1 |
|
~%
2-Selenazolamin... CAS#:7770-61-8 |
| Literature: King; Hlavacek Journal of the American Chemical Society, 1951 , vol. 73, p. 1864 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |