2(3H)-Furanone,3,5-bis[(3,4-dimethoxyphenyl)methyl]dihydro- structure
|
Common Name | 2(3H)-Furanone,3,5-bis[(3,4-dimethoxyphenyl)methyl]dihydro- | ||
|---|---|---|---|---|
| CAS Number | 7770-67-4 | Molecular Weight | 386.43800 | |
| Density | 1.175g/cm3 | Boiling Point | 545.6ºC at 760 mmHg | |
| Molecular Formula | C22H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.2ºC | |
| Name | 3,5-bis[(3,4-dimethoxyphenyl)methyl]oxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 545.6ºC at 760 mmHg |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.43800 |
| Flash Point | 237.2ºC |
| Exact Mass | 386.17300 |
| PSA | 63.22000 |
| LogP | 3.43790 |
| Index of Refraction | 1.552 |
| InChIKey | TXUHOJCTBHLKBA-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2CC(Cc3ccc(OC)c(OC)c3)C(=O)O2)cc1OC |
|
~%
2(3H)-Furanone,... CAS#:7770-67-4 |
| Literature: Haworth et al. Journal of the Chemical Society, 1936 , p. 725,729 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,5-diveratryl-dihydro-furan-2-one |