Silane, (1,1-dimethylethyl)dimethyl[[(1R)-2-methyl-2-cyclopenten-1-yl]oxy]- (9CI) structure
|
Common Name | Silane, (1,1-dimethylethyl)dimethyl[[(1R)-2-methyl-2-cyclopenten-1-yl]oxy]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 777076-74-1 | Molecular Weight | 212.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-dimethyl-[(1R)-2-methylcyclopent-2-en-1-yl]oxysilane |
|---|
| Molecular Formula | C12H24OSi |
|---|---|
| Molecular Weight | 212.40400 |
| Exact Mass | 212.16000 |
| PSA | 9.23000 |
| LogP | 4.11690 |
| InChIKey | UFLDXRGRABJXCI-LLVKDONJSA-N |
| SMILES | CC1=CCCC1O[Si](C)(C)C(C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |