[2-[methyl-(4-phenylsulfanylphenyl)carbamoyl]phenyl] acetate structure
|
Common Name | [2-[methyl-(4-phenylsulfanylphenyl)carbamoyl]phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 77711-72-9 | Molecular Weight | 377.45600 | |
| Density | 1.28g/cm3 | Boiling Point | 565.7ºC at 760 mmHg | |
| Molecular Formula | C22H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.9ºC | |
| Name | [2-[methyl-(4-phenylsulfanylphenyl)carbamoyl]phenyl] acetate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 565.7ºC at 760 mmHg |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.45600 |
| Flash Point | 295.9ºC |
| Exact Mass | 377.10900 |
| PSA | 71.91000 |
| LogP | 5.03970 |
| Index of Refraction | 1.658 |
| InChIKey | MSDJXHROWFTINH-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)N(C)c1ccc(Sc2ccccc2)cc1 |
|
~46%
[2-[methyl-(4-p... CAS#:77711-72-9 |
| Literature: Marcincal-Lefebvre; Gesquiere; Lemer; Dupuis Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 889 - 893 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |