1H-Pyrrole-3-carboxylic acid, 2,5-dihydro-1-methyl-5-oxo-4-((4-(phenyl thio)phenyl)amino)-, ethyl ester structure
|
Common Name | 1H-Pyrrole-3-carboxylic acid, 2,5-dihydro-1-methyl-5-oxo-4-((4-(phenyl thio)phenyl)amino)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 77711-87-6 | Molecular Weight | 368.44900 | |
| Density | 1.3g/cm3 | Boiling Point | 581.4ºC at 760 mmHg | |
| Molecular Formula | C20H20N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.4ºC | |
| Name | ethyl 1-methyl-5-oxo-4-(4-phenylsulfanylanilino)-2H-pyrrole-3-carboxylate |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 581.4ºC at 760 mmHg |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.44900 |
| Flash Point | 305.4ºC |
| Exact Mass | 368.11900 |
| PSA | 83.94000 |
| LogP | 3.54980 |
| Index of Refraction | 1.652 |
| InChIKey | YTPNBTOTLNRARN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(Nc2ccc(Sc3ccccc3)cc2)C(=O)N(C)C1 |
|
~72%
1H-Pyrrole-3-ca... CAS#:77711-87-6 |
| Literature: Marcincal-Lefebvre; Gesquiere; Lemer; Dupuis Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 889 - 893 |