Tiantoina structure
|
Common Name | Tiantoina | ||
|---|---|---|---|---|
| CAS Number | 7772-37-4 | Molecular Weight | 258.29600 | |
| Density | 1.359g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.29600 |
| Exact Mass | 258.04600 |
| PSA | 86.44000 |
| LogP | 2.48870 |
| Index of Refraction | 1.634 |
| InChIKey | DCPACFSINCUFEC-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2cccs2)N1 |
|
~%
Tiantoina CAS#:7772-37-4 |
| Literature: Spurlock Journal of the American Chemical Society, 1953 , vol. 75, p. 1115 |
|
~%
Tiantoina CAS#:7772-37-4 |
| Literature: Bergmann,P. et al. Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft, 1966 , vol. 299, p. 499 - 503 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Thyphenytoin |
| 5-phenyl-5-thiophen-2-yl-imidazolidine-2,4-dione |
| UNII-0H34NO7B6N |
| Tiantoina |
| 5-Phenyl-5-<2>thienyl-hydantoin |
| Thiantoine |
| Phethenylate |
| Thiantoin |