2,2'-[Methylenebis(p-phenylene)]bis(guanidine) structure
|
Common Name | 2,2'-[Methylenebis(p-phenylene)]bis(guanidine) | ||
|---|---|---|---|---|
| CAS Number | 7773-73-1 | Molecular Weight | 282.34400 | |
| Density | 1.32g/cm3 | Boiling Point | 562.8ºC at 760 mmHg | |
| Molecular Formula | C15H18N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | 2-[4-[[4-(diaminomethylideneamino)phenyl]methyl]phenyl]guanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 562.8ºC at 760 mmHg |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.34400 |
| Flash Point | 294.2ºC |
| Exact Mass | 282.15900 |
| PSA | 123.80000 |
| LogP | 3.63420 |
| Index of Refraction | 1.675 |
| InChIKey | VPFQDYYIEBRWAW-UHFFFAOYSA-N |
| SMILES | NC(N)=Nc1ccc(Cc2ccc(N=C(N)N)cc2)cc1 |
|
~%
2,2'-[Methylene... CAS#:7773-73-1 |
| Literature: Braun; Erit; Crooks Journal of Organic Chemistry, 1938 , vol. 3, p. 146,149 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| GUANIDINE,4,4'-METHYLENEDIPHENYLDI |
| p,p'-Diguanidinodiphenylmethane |