Oxayohimban-16-carboxylic acid, 16,17-didehydro-19-methyl-, (19-alpha, 20-alpha)-, compd. with 2-aminoethanol (1:1) structure
|
Common Name | Oxayohimban-16-carboxylic acid, 16,17-didehydro-19-methyl-, (19-alpha, 20-alpha)-, compd. with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 77754-96-2 | Molecular Weight | 399.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tetrahydroalstonate d'aminoethanol |
|---|
| Molecular Formula | C22H29N3O4 |
|---|---|
| Molecular Weight | 399.48300 |
| Exact Mass | 399.21600 |
| PSA | 111.81000 |
| LogP | 2.66600 |
| InChIKey | SPGGZGIRJNEIIO-BEXXLDLDSA-N |
| SMILES | CC1OC=C(C(=O)O)C2CC3c4[nH]c5ccccc5c4CCN3CC12.NCCO |