2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid
![2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid Structure](https://image.chemsrc.com/caspic/055/7776-33-2.png)
2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid structure
|
Common Name | 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7776-33-2 | Molecular Weight | 362.14400 | |
| Density | N/A | Boiling Point | 571.2ºC at 760 mmHg | |
| Molecular Formula | C8H16N2O4Se2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 571.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H16N2O4Se2 |
| Molecular Weight | 362.14400 |
| Flash Point | 299.3ºC |
| Exact Mass | 363.94400 |
| PSA | 126.64000 |
| LogP | 0.15100 |
| InChIKey | NBQXBIDZPLKFHR-UHFFFAOYSA-N |
| SMILES | NC(CC[Se][Se]CCC(N)C(=O)O)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~51%
2-amino-4-[(3-a... CAS#:7776-33-2 |
| Literature: Chocat, Patrick; Esaki, Nobuyoshi; Tanaka, Hidehiko; Soda, Kenji Agricultural and Biological Chemistry, 1985 , vol. 49, # 4 p. 1143 - 1150 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2'-Diamino-4,4'-diselandiyl-di-buttersaeure |
| 2.2'-Diamino-4.4'-diseleno-dibuttersaeure |
| 2,2'-diamino-4,4'-diselanediyl-di-butyric acid |
| selenohomocystine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: CAS number of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is 7776-33-2. |
| Q: What is the English name of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: The English name of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid. |
| Q: What is the molecular formula of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: Molecular formula of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is C8H16N2O4Se2. |
| Q: What is the LogP of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: LogP of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is 0.15100. |
| Q: What English synonyms does 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid have? |
| A: English synonyms of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid: 2,2'-Diamino-4,4'-diselandiyl-di-buttersaeure, 2.2'-Diamino-4.4'-diseleno-dibuttersaeure, 2,2'-diamino-4,4'-diselanediyl-di-butyric acid, selenohomocystine. |
| Q: What is the polar surface area (PSA) of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: Polar surface area (PSA) of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is 126.64000. |
| Q: What is the SMILES notation of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: SMILES notation of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is NC(CC[Se][Se]CCC(N)C(=O)O)C(=O)O. |
| Q: What is the molecular weight of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: Molecular weight of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is 362.14400. |
| Q: What is the boiling point of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid? |
| A: Boiling point of 2-amino-4-[(3-amino-3-carboxypropyl)diselanyl]butanoic acid is 571.2ºC at 760 mmHg. |
| Q: What is the Chinese name of 7776-33-2? |
| A: Chinese name of 7776-33-2 is 7776-33-2. |