3,7-bis-(4-trifluoromethylphenyl)-1,5,3,7-dioxadiazocane structure
|
Common Name | 3,7-bis-(4-trifluoromethylphenyl)-1,5,3,7-dioxadiazocane | ||
|---|---|---|---|---|
| CAS Number | 77767-16-9 | Molecular Weight | 406.32200 | |
| Density | 1.347g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C18H16F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.6ºC | |
| Name | 3,7-bis[4-(trifluoromethyl)phenyl]-1,5,3,7-dioxadiazocane |
|---|
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C18H16F6N2O2 |
| Molecular Weight | 406.32200 |
| Flash Point | 243.6ºC |
| Exact Mass | 406.11200 |
| PSA | 24.94000 |
| LogP | 5.04400 |
| Index of Refraction | 1.493 |
| InChIKey | UBIWNRIKGVTTKH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(N2COCN(c3ccc(C(F)(F)F)cc3)COC2)cc1 |
| HS Code | 2933990090 |
|---|
|
~83%
3,7-bis-(4-trif... CAS#:77767-16-9 |
| Literature: Becker; Rohr 1981 , vol. No. 2, p. 191 - 197 |
|
~%
3,7-bis-(4-trif... CAS#:77767-16-9 |
| Literature: Kolar, George F.; Schendzielorz, Michael Tetrahedron Letters, 1985 , vol. 26, # 8 p. 1043 - 1044 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |