Schottenone
Modify Date: 2025-09-09 16:13:40
Schottenone structure
|
Common Name | Schottenone | ||
|---|---|---|---|---|
| CAS Number | 77790-54-6 | Molecular Weight | 412.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H48O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Schottenone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C29H48O |
|---|---|
| Molecular Weight | 412.7 |
| InChIKey | JWANJDUXWSJWER-KMCRJJFKSA-N |
| SMILES | CCC(CCC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC21C)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Schottenone? |
| A: Molecular weight of Schottenone is 412.7. |
| Q: What is the molecular formula of Schottenone? |
| A: Molecular formula of Schottenone is C29H48O. |
| Q: What is the English name of Schottenone? |
| A: The English name of Schottenone is Schottenone. |
| Q: What is the SMILES notation of Schottenone? |
| A: SMILES notation of Schottenone is CCC(CCC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC21C)C(C)C. |
| Q: What is the CAS number of Schottenone? |
| A: CAS number of Schottenone is 77790-54-6. |
| Q: What is the InChIKey of Schottenone? |
| A: InChIKey of Schottenone is JWANJDUXWSJWER-KMCRJJFKSA-N. |
| Q: What is the Chinese name of 77790-54-6? |
| A: Chinese name of 77790-54-6 is 77790-54-6. |