3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline
Modify Date: 2026-07-03 19:44:47
3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline structure
|
Common Name | 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 777931-68-7 | Molecular Weight | 209.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8ClNO2 |
|---|---|
| Molecular Weight | 209.63 |
| InChIKey | IABKRPBNSVQPST-UHFFFAOYSA-N |
| SMILES | COc1nc(Cl)cc2c1C1C=CC2O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline? |
| A: Molecular formula of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline is C10H8ClNO2. |
| Q: What is the Chinese name of 777931-68-7? |
| A: Chinese name of 777931-68-7 is 777931-68-7. |
| Q: What is the InChIKey of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline? |
| A: InChIKey of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline is IABKRPBNSVQPST-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline? |
| A: Molecular weight of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline is 209.63. |
| Q: What is the English name of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline? |
| A: The English name of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline is 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline. |
| Q: What is the SMILES notation of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline? |
| A: SMILES notation of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline is COc1nc(Cl)cc2c1C1C=CC2O1. |
| Q: What is the CAS number of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline? |
| A: CAS number of 3-Chloro-5,8-dihydro-1-methoxy-5,8-epoxyisoquinoline is 777931-68-7. |