5-Methyl-3-phenylimidazo[5,1-b]thiazole
Modify Date: 2026-06-27 13:17:58
![5-Methyl-3-phenylimidazo[5,1-b]thiazole Structure](https://www.chemsrc.com/extcaspic/442/778-57-4.png)
5-Methyl-3-phenylimidazo[5,1-b]thiazole structure
|
Common Name | 5-Methyl-3-phenylimidazo[5,1-b]thiazole | ||
|---|---|---|---|---|
| CAS Number | 778-57-4 | Molecular Weight | 214.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Methyl-3-phenylimidazo[5,1-b]thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2S |
|---|---|
| Molecular Weight | 214.29 |
| InChIKey | YAZDRUMKVXBCRV-UHFFFAOYSA-N |
| SMILES | Cc1ncc2scc(-c3ccccc3)n12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Methyl-3-phenylimidazo[5,1-b]thiazole? |
| A: Molecular weight of 5-Methyl-3-phenylimidazo[5,1-b]thiazole is 214.29. |
| Q: What is the Chinese name of 778-57-4? |
| A: Chinese name of 778-57-4 is 778-57-4. |
| Q: What is the SMILES notation of 5-Methyl-3-phenylimidazo[5,1-b]thiazole? |
| A: SMILES notation of 5-Methyl-3-phenylimidazo[5,1-b]thiazole is Cc1ncc2scc(-c3ccccc3)n12. |
| Q: What is the InChIKey of 5-Methyl-3-phenylimidazo[5,1-b]thiazole? |
| A: InChIKey of 5-Methyl-3-phenylimidazo[5,1-b]thiazole is YAZDRUMKVXBCRV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-Methyl-3-phenylimidazo[5,1-b]thiazole? |
| A: Molecular formula of 5-Methyl-3-phenylimidazo[5,1-b]thiazole is C12H10N2S. |
| Q: What is the English name of 5-Methyl-3-phenylimidazo[5,1-b]thiazole? |
| A: The English name of 5-Methyl-3-phenylimidazo[5,1-b]thiazole is 5-Methyl-3-phenylimidazo[5,1-b]thiazole. |
| Q: What is the CAS number of 5-Methyl-3-phenylimidazo[5,1-b]thiazole? |
| A: CAS number of 5-Methyl-3-phenylimidazo[5,1-b]thiazole is 778-57-4. |