4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl
Modify Date: 2026-08-05 22:14:30
4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl structure
|
Common Name | 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl | ||
|---|---|---|---|---|
| CAS Number | 778-89-2 | Molecular Weight | 204.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N2O2 |
|---|---|
| Molecular Weight | 204.22 |
| InChIKey | XHLOZVHHBVPOHP-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c(=O)nc(N(C)C)oc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 778-89-2? |
| A: Chinese name of 778-89-2 is 778-89-2. |
| Q: What is the InChIKey of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl? |
| A: InChIKey of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl is XHLOZVHHBVPOHP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl? |
| A: Molecular formula of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl is C11H12N2O2. |
| Q: What is the English name of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl? |
| A: The English name of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl is 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl. |
| Q: What is the CAS number of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl? |
| A: CAS number of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl is 778-89-2. |
| Q: What is the SMILES notation of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl? |
| A: SMILES notation of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl is Cc1cccc2c(=O)nc(N(C)C)oc12. |
| Q: What is the molecular weight of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl? |
| A: Molecular weight of 4h-1,3-Benzoxazin-4-one,2-(dimethylamino)-8-methyl is 204.22. |