2-(3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid structure
|
Common Name | 2-(3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 77832-22-5 | Molecular Weight | 265.32800 | |
| Density | 1.317g/cm3 | Boiling Point | 521.7ºC at 760 mmHg | |
| Molecular Formula | C13H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.3ºC | |
| Name | 2-(3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 521.7ºC at 760 mmHg |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.32800 |
| Flash Point | 269.3ºC |
| Exact Mass | 265.07700 |
| PSA | 96.41000 |
| LogP | 1.28230 |
| Index of Refraction | 1.61 |
| InChIKey | SBTLGJFPUKNYNC-UHFFFAOYSA-N |
| SMILES | O=C(O)C1Cc2ccccc2CN1C(=O)CCS |
|
Name: In vitro inhibition of Angiotensin I converting enzyme
Source: ChEMBL
Target: Angiotensin-converting enzyme
External Id: CHEMBL643766
|
| eu 4865 |