(1-bromo-2-propan-2-ylindolizin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone structure
|
Common Name | (1-bromo-2-propan-2-ylindolizin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 77833-08-0 | Molecular Weight | 516.02100 | |
| Density | 1.85g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H14Br3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-bromo-2-propan-2-ylindolizin-3-yl)-(3,5-dibromo-4-hydroxyphenyl)methanone |
|---|
| Density | 1.85g/cm3 |
|---|---|
| Molecular Formula | C18H14Br3NO2 |
| Molecular Weight | 516.02100 |
| Exact Mass | 512.85700 |
| PSA | 41.71000 |
| LogP | 6.28680 |
| Index of Refraction | 1.685 |
| InChIKey | BCLMMCYKWKQQCB-UHFFFAOYSA-N |
| SMILES | CC(C)c1c(Br)c2ccccn2c1C(=O)c1cc(Br)c(O)c(Br)c1 |
|
~10%
(1-bromo-2-prop... CAS#:77833-08-0 |
| Literature: Rosseels; Peiren; Cornil; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 339 - 346 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |