4-amino-N-[3-(diethylamino)propyl]benzenesulfonamide structure
|
Common Name | 4-amino-N-[3-(diethylamino)propyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 77837-49-1 | Molecular Weight | 285.40600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-N-[3-(diethylamino)propyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H23N3O2S |
|---|---|
| Molecular Weight | 285.40600 |
| Exact Mass | 285.15100 |
| PSA | 83.81000 |
| LogP | 3.33190 |
| InChIKey | SHJRPNYAZUJBBP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNS(=O)(=O)c1ccc(N)cc1 |
|
~%
4-amino-N-[3-(d... CAS#:77837-49-1 |
| Literature: Whitmore et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 725,728 |
|
~%
4-amino-N-[3-(d... CAS#:77837-49-1 |
| Literature: Whitmore et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 725,728 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N'-Sulfanilyl-N.N-diaethyl-propandiyldiamin |