[2-(4-methoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester structure
|
Common Name | [2-(4-methoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 778617-61-1 | Molecular Weight | 265.30500 | |
| Density | 1.106g/cm3 | Boiling Point | 421.4ºC at 760 mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.7ºC | |
| Name | [2-(4-methoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760 mmHg |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.30500 |
| Flash Point | 208.7ºC |
| Exact Mass | 265.13100 |
| PSA | 64.63000 |
| LogP | 2.79350 |
| Index of Refraction | 1.507 |
| InChIKey | MDFLXFYNPWKUEE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CNC(=O)OC(C)(C)C)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |