2-(4-chlorobenzoyl)-5-methyl-4H-pyrazol-3-one structure
|
Common Name | 2-(4-chlorobenzoyl)-5-methyl-4H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 77869-84-2 | Molecular Weight | 236.65400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorobenzoyl)-5-methyl-4H-pyrazol-3-one |
|---|
| Molecular Formula | C11H9ClN2O2 |
|---|---|
| Molecular Weight | 236.65400 |
| Exact Mass | 236.03500 |
| PSA | 49.74000 |
| LogP | 1.46190 |
| InChIKey | HSCXLUZKSGGMHM-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)c2ccc(Cl)cc2)C(=O)C1 |
|
~90%
2-(4-chlorobenz... CAS#:77869-84-2 |
| Literature: Pathak, R. B.; Bahel, S. C. Journal of the Indian Chemical Society, 1980 , vol. 57, p. 1108 - 1111 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |