2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide
Modify Date: 2025-08-27 15:45:38
![2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide Structure](https://www.chemsrc.com/extcaspic/368/77871-84-2.png)
2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide structure
|
Common Name | 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 77871-84-2 | Molecular Weight | 215.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13N3O |
|---|---|
| Molecular Weight | 215.25 |
| InChIKey | SWRKTKBVJYIDTG-UHFFFAOYSA-N |
| SMILES | NC(=O)C1Cc2c([nH]c3ccccc23)CN1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide? |
| A: CAS number of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide is 77871-84-2. |
| Q: What is the InChIKey of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide? |
| A: InChIKey of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide is SWRKTKBVJYIDTG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 77871-84-2? |
| A: Chinese name of 77871-84-2 is 77871-84-2. |
| Q: What is the SMILES notation of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide? |
| A: SMILES notation of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide is NC(=O)C1Cc2c([nH]c3ccccc23)CN1. |
| Q: What is the molecular formula of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide? |
| A: Molecular formula of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide is C12H13N3O. |
| Q: What is the English name of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide? |
| A: The English name of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide is 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide. |
| Q: What is the molecular weight of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide? |
| A: Molecular weight of 2,3,4,9-Tetrahydro-1H-pyrido[3,4-B]indole-3-carboxamide is 215.25. |