4'-Chloro-4-methoxy-3-biphenylacetic acid structure
|
Common Name | 4'-Chloro-4-methoxy-3-biphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 77894-08-7 | Molecular Weight | 276.71500 | |
| Density | 1.268g/cm3 | Boiling Point | 432.4ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | 2-[5-(4-chlorophenyl)-2-methoxyphenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 432.4ºC at 760 mmHg |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.71500 |
| Flash Point | 215.3ºC |
| Exact Mass | 276.05500 |
| PSA | 46.53000 |
| LogP | 3.64270 |
| Index of Refraction | 1.589 |
| InChIKey | XJQBKQUXUQRYJO-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(Cl)cc2)cc1CC(=O)O |
| HS Code | 2922299090 |
|---|
|
~95%
4'-Chloro-4-met... CAS#:77894-08-7 |
| Literature: Tamura, Yasumitsu; Yoshimoto, Yoshihiko; Tada, Shin-ichi; Kunimoto, Katsutoshi; Matsumura, Shingo; et al. Journal of Medicinal Chemistry, 1981 , vol. 24, # 8 p. 1006 - 1010 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-BIPHENYLACETIC ACID,4'-CHLORO-4-METHOXY |
| 4'-Chloro-4-methoxy-(1,1'-biphenyl)-3-acetic acid |
| 4'-Chloro-4-methoxy-3-biphenylacetic acid |
| (1,1'-Biphenyl)-3-acetic acid,4'-chloro-4-methoxy |