2-[2-(4-chlorophenyl)-6-methoxyphenyl]acetic acid structure
|
Common Name | 2-[2-(4-chlorophenyl)-6-methoxyphenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 77894-14-5 | Molecular Weight | 276.71500 | |
| Density | 1.268g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 2-[2-(4-chlorophenyl)-6-methoxyphenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.71500 |
| Flash Point | 220.9ºC |
| Exact Mass | 276.05500 |
| PSA | 46.53000 |
| LogP | 3.64270 |
| Index of Refraction | 1.589 |
| InChIKey | BMRFDTBYGKZEEI-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ccc(Cl)cc2)c1CC(=O)O |
|
~86%
2-[2-(4-chlorop... CAS#:77894-14-5 |
| Literature: Tamura, Yasumitsu; Yoshimoto, Yoshihiko; Tada, Shin-ichi; Kunimoto, Katsutoshi; Matsumura, Shingo; et al. Journal of Medicinal Chemistry, 1981 , vol. 24, # 8 p. 1006 - 1010 |
|
~%
2-[2-(4-chlorop... CAS#:77894-14-5 |
| Literature: Tamura, Yasumitsu; Yoshimoto, Yoshihiko; Tada, Shin-ichi; Kunimoto, Katsutoshi; Matsumura, Shingo; et al. Journal of Medicinal Chemistry, 1981 , vol. 24, # 8 p. 1006 - 1010 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-BIPHENYLACETIC ACID,4'-CHLORO-3-METHOXY |
| 4'-Chloro-3-methoxy-2-biphenylacetic acid |