2H-1,2,3-Triazole,4-methyl-2-phenyl-, 1-oxide structure
|
Common Name | 2H-1,2,3-Triazole,4-methyl-2-phenyl-, 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 77896-41-4 | Molecular Weight | 175.18700 | |
| Density | 1.22g/cm3 | Boiling Point | 346.8ºC at 760mmHg | |
| Molecular Formula | C9H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 4-methyl-1-oxido-2-phenyltriazol-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 346.8ºC at 760mmHg |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.18700 |
| Flash Point | 163.6ºC |
| Exact Mass | 175.07500 |
| PSA | 43.28000 |
| LogP | 1.60920 |
| Index of Refraction | 1.624 |
| InChIKey | RHDDSMYWBSVLBS-UHFFFAOYSA-N |
| SMILES | Cc1c[n+]([O-])n(-c2ccccc2)n1 |
|
~87%
2H-1,2,3-Triazo... CAS#:77896-41-4 |
| Literature: Begtrup, Mikael; Holm, John Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 503 - 513 |
|
~%
2H-1,2,3-Triazo... CAS#:77896-41-4 |
| Literature: Kirillova; Shul'gina; Shafeev; Al'mukhamedov; Vereshchagin Russian Journal of Organic Chemistry, 1996 , vol. 32, # 7 p. 1051 - 1054 |
|
~%
2H-1,2,3-Triazo... CAS#:77896-41-4 |
| Literature: Kirillova; Shul'gina; Shafeev; Al'mukhamedov; Vereshchagin Russian Journal of Organic Chemistry, 1996 , vol. 32, # 7 p. 1051 - 1054 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-methyl-2-phenyl-2H-[1,2,3]triazole 1-oxide |
| 4-Methyl-2-phenyl-2H-[1,2,3]triazol-1-oxid |