4-acetoxy-2-phenyl-1,2,3-triazole
Modify Date: 2025-09-30 14:36:54
4-acetoxy-2-phenyl-1,2,3-triazole structure
|
Common Name | 4-acetoxy-2-phenyl-1,2,3-triazole | ||
|---|---|---|---|---|
| CAS Number | 77896-55-0 | Molecular Weight | 203.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-acetoxy-2-phenyl-1,2,3-triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9N3O2 |
|---|---|
| Molecular Weight | 203.19700 |
| Exact Mass | 203.06900 |
| PSA | 57.01000 |
| LogP | 1.19260 |
| InChIKey | BMXRKNNPHGMZSL-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cnn(-c2ccccc2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: Polar surface area (PSA) of 4-acetoxy-2-phenyl-1,2,3-triazole is 57.01000. |
| Q: What is the English name of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: The English name of 4-acetoxy-2-phenyl-1,2,3-triazole is 4-acetoxy-2-phenyl-1,2,3-triazole. |
| Q: What is the molecular weight of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: Molecular weight of 4-acetoxy-2-phenyl-1,2,3-triazole is 203.19700. |
| Q: What is the SMILES notation of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: SMILES notation of 4-acetoxy-2-phenyl-1,2,3-triazole is CC(=O)Oc1cnn(-c2ccccc2)n1. |
| Q: What is the Chinese name of 77896-55-0? |
| A: Chinese name of 77896-55-0 is 77896-55-0. |
| Q: What is the LogP of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: LogP of 4-acetoxy-2-phenyl-1,2,3-triazole is 1.19260. |
| Q: What is the CAS number of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: CAS number of 4-acetoxy-2-phenyl-1,2,3-triazole is 77896-55-0. |
| Q: What is the InChIKey of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: InChIKey of 4-acetoxy-2-phenyl-1,2,3-triazole is BMXRKNNPHGMZSL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-acetoxy-2-phenyl-1,2,3-triazole? |
| A: Molecular formula of 4-acetoxy-2-phenyl-1,2,3-triazole is C10H9N3O2. |