2,3-Piperazinedione, 1-(p-((5-amino-6-methyl-2-pyridyl)amino)benzyl)-4-benzyl- structure
|
Common Name | 2,3-Piperazinedione, 1-(p-((5-amino-6-methyl-2-pyridyl)amino)benzyl)-4-benzyl- | ||
|---|---|---|---|---|
| CAS Number | 77917-42-1 | Molecular Weight | 415.48800 | |
| Density | 1.314g/cm3 | Boiling Point | 630.2ºC at 760 mmHg | |
| Molecular Formula | C24H25N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.9ºC | |
| Name | 1-[[4-[(5-amino-6-methylpyridin-2-yl)amino]phenyl]methyl]-4-benzylpiperazine-2,3-dione |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 630.2ºC at 760 mmHg |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.48800 |
| Flash Point | 334.9ºC |
| Exact Mass | 415.20100 |
| PSA | 91.56000 |
| LogP | 3.61680 |
| Index of Refraction | 1.689 |
| InChIKey | DRUDXKIZYJISHH-UHFFFAOYSA-N |
| SMILES | Cc1nc(Nc2ccc(CN3CCN(Cc4ccccc4)C(=O)C3=O)cc2)ccc1N |
| HS Code | 2933990090 |
|---|
|
~%
2,3-Piperazined... CAS#:77917-42-1 |
| Literature: Hori; Yoshida; Murakami; Takeno; Kiba; Tsuda; Kishimoto; Saikawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 6 p. 1594 - 1605 |
|
~%
2,3-Piperazined... CAS#:77917-42-1 |
| Literature: Hori; Yoshida; Murakami; Takeno; Kiba; Tsuda; Kishimoto; Saikawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 6 p. 1594 - 1605 |
|
~%
2,3-Piperazined... CAS#:77917-42-1 |
| Literature: Hori; Yoshida; Murakami; Takeno; Kiba; Tsuda; Kishimoto; Saikawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 6 p. 1594 - 1605 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |