3-Octanone,1-(ethylthio)-4-methyl-1-phenyl- structure
|
Common Name | 3-Octanone,1-(ethylthio)-4-methyl-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 77921-33-6 | Molecular Weight | 278.45300 | |
| Density | 0.983g/cm3 | Boiling Point | 376.7ºC at 760mmHg | |
| Molecular Formula | C17H26OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 1-ethylsulfanyl-4-methyl-1-phenyloctan-3-one |
|---|
| Density | 0.983g/cm3 |
|---|---|
| Boiling Point | 376.7ºC at 760mmHg |
| Molecular Formula | C17H26OS |
| Molecular Weight | 278.45300 |
| Flash Point | 182.3ºC |
| Exact Mass | 278.17000 |
| PSA | 42.37000 |
| LogP | 5.26630 |
| Index of Refraction | 1.516 |
| InChIKey | NXDXTCXOKJTATK-UHFFFAOYSA-N |
| SMILES | CCCCC(C)C(=O)CC(SCC)c1ccccc1 |
|
~%
3-Octanone,1-(e... CAS#:77921-33-6 |
| Literature: Dimmock, J.R.; Smith, L.M.; Smith, P.J. Canadian Journal of Chemistry, 1980 , vol. 58, p. 984 - 991 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |