4-(4-chlorophenyl)thiazole-2-carboxylic acid structure
|
Common Name | 4-(4-chlorophenyl)thiazole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 779320-20-6 | Molecular Weight | 239.678 | |
| Density | 1.480±0.06 g/cm3 | Boiling Point | 454.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.9±26.5 °C | |
| Name | 4-(4-chlorophenyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.480±0.06 g/cm3 |
|---|---|
| Boiling Point | 454.9±37.0 °C at 760 mmHg |
| Molecular Formula | C10H6ClNO2S |
| Molecular Weight | 239.678 |
| Flash Point | 228.9±26.5 °C |
| Exact Mass | 238.980774 |
| PSA | 78.43000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | JOMOAMJPPUFTSI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc(-c2ccc(Cl)cc2)cs1 |
| Water Solubility | Practically insoluble (0.041 g/L) (25 ºC) |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(4-Chlorophenyl)-1,3-thiazole-2-carboxylic acid |
| 2-Thiazolecarboxylic acid, 4-(4-chlorophenyl)- |
| 4-(4-Chlorophenyl)-2-thiazolecarboxylic acid |
| 4-(4-chlorophenyl)thiazole-2-carboxylic acid |