2,7-bis(chloromethyl)-3,8-dioxaspiro[4.4]nonane-4,9-dione structure
|
Common Name | 2,7-bis(chloromethyl)-3,8-dioxaspiro[4.4]nonane-4,9-dione | ||
|---|---|---|---|---|
| CAS Number | 77944-07-1 | Molecular Weight | 253.07900 | |
| Density | 1.47g/cm3 | Boiling Point | 507ºC at 760 mmHg | |
| Molecular Formula | C9H10Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8ºC | |
| Name | 3,8-bis(chloromethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 507ºC at 760 mmHg |
| Molecular Formula | C9H10Cl2O4 |
| Molecular Weight | 253.07900 |
| Flash Point | 232.8ºC |
| Exact Mass | 251.99600 |
| PSA | 52.60000 |
| LogP | 1.08140 |
| Index of Refraction | 1.529 |
| InChIKey | HWZHLKQPHKYGQI-UHFFFAOYSA-N |
| SMILES | O=C1OC(CCl)CC12CC(CCl)OC2=O |
|
~75%
2,7-bis(chlorom... CAS#:77944-07-1 |
| Literature: Damin, Bernard; Forestiere, Alain; Garapon, Jacques; Sillion, Bernard Journal of Organic Chemistry, 1981 , vol. 46, # 17 p. 3552 - 3554 |
|
~%
2,7-bis(chlorom... CAS#:77944-07-1 |
| Literature: Leuchs; Lemcke Chemische Berichte, 1914 , vol. 47, p. 2584 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,7-bis(chloromethyl)-3,8-dioxaspiro[4.4]nonane-4,9-dione |
| 3,8-Bis-chlormethyl-2,7-dioxa-spiro[4.4]nonan-1,6-dion |
| 3,8-bis-chloromethyl-2,7-dioxa-spiro[4.4]nonane-1,6-dione |