methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate
methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate structure
|
Common Name | methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 77959-48-9 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate (CAS number: 77959-48-9) is a chemical substance with molecular formula C12H14O4 and molecular weight 222.23700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.74970 |
| InChIKey | LMGDXEZEUHTSEE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(C)C(=O)OC)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:67381-50-4![4-[1-(2,4-diaminopteridin-6-yl)propan-2-yl]benzoic acid structure](https://image.chemsrc.com/caspic/194/80576-76-7.png)
CAS#:80576-76-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: Related downstream products(CAS) of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate: 67381-50-4;80576-76-7. |
| Q: What is the polar surface area (PSA) of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: Polar surface area (PSA) of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is 52.60000. |
| Q: What is the SMILES notation of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: SMILES notation of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is COC(=O)c1ccc(C(C)C(=O)OC)cc1. |
| Q: What is the LogP of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: LogP of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is 1.74970. |
| Q: What is the English name of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: The English name of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate. |
| Q: What is the CAS number of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: CAS number of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is 77959-48-9. |
| Q: What is the molecular formula of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: Molecular formula of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is C12H14O4. |
| Q: What is the Chinese name of 77959-48-9? |
| A: Chinese name of 77959-48-9 is 77959-48-9. |
| Q: What is the molecular weight of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: Molecular weight of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is 222.23700. |
| Q: What is the InChIKey of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate? |
| A: InChIKey of methyl 4-(1-methoxy-1-oxopropan-2-yl)benzoate is LMGDXEZEUHTSEE-UHFFFAOYSA-N. |