N'-(3-benzyl-5-cyanotriazol-4-yl)oxamide structure
|
Common Name | N'-(3-benzyl-5-cyanotriazol-4-yl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 77976-40-0 | Molecular Weight | 270.24700 | |
| Density | 1.48g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(3-benzyl-5-cyanotriazol-4-yl)oxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.24700 |
| Exact Mass | 270.08700 |
| PSA | 126.69000 |
| LogP | 0.39518 |
| Index of Refraction | 1.714 |
| InChIKey | RSOHXTLJMHTTNE-UHFFFAOYSA-N |
| SMILES | N#Cc1nnn(Cc2ccccc2)c1NC(=O)C(N)=O |
|
~91%
N'-(3-benzyl-5-... CAS#:77976-40-0 |
| Literature: Albert, Adrien Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 887 - 891 |
|
~%
N'-(3-benzyl-5-... CAS#:77976-40-0 |
| Literature: Albert, Adrien Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 887 - 891 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Acetamide,2,3-triazol-5-yl]amino]-2-oxo |
| 3-benzyl-4-oxamoylamino-3H-1,2,3-triazole-5-carbonitrile |