2-(Diethylamino)ethyl 2,4-diphenylbutyrate
Modify Date: 2025-11-16 10:24:45
2-(Diethylamino)ethyl 2,4-diphenylbutyrate structure
|
Common Name | 2-(Diethylamino)ethyl 2,4-diphenylbutyrate | ||
|---|---|---|---|---|
| CAS Number | 77985-15-0 | Molecular Weight | 339.47100 | |
| Density | 1.039g/cm3 | Boiling Point | 448.6ºC at 760 mmHg | |
| Molecular Formula | C22H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | 2-(diethylamino)ethyl 2,4-diphenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760 mmHg |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.47100 |
| Flash Point | 132.8ºC |
| Exact Mass | 339.22000 |
| PSA | 29.54000 |
| LogP | 4.28800 |
| Index of Refraction | 1.542 |
| InChIKey | RHQLGMFQMOJMSC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C(CCc1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
|
~%
2-(Diethylamino... CAS#:77985-15-0 |
| Literature: Wagner-Jauregg; Arnold; Born Chemische Berichte, 1939 , vol. 72, p. 1551,1554 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-diethylaminoethyl 2,4-diphenylbutanoate |
| 2,4-Diphenyl-buttersaeure-<2-diaethylamino-aethylester> |